6929-08-4 3-Undecanol
product Name |
3-Undecanol |
CAS No |
6929-08-4 |
Synonyms |
Ethyl n-octyl carbinol; undecan-3-ol |
Molecular Formula |
C11H24O |
Molecular Weight |
172.3077 |
InChI |
InChI=1/C11H24O/c1-3-5-6-7-8-9-10-11(12)4-2/h11-12H,3-10H2,1-2H3 |
EINECS |
230-054-2 |
Molecular Structure |
|
Density |
0.828g/cm3 |
Boiling point |
229.7°C at 760 mmHg |
Refractive index |
1.437 |
Flash point |
94°C |
Vapour Pressur |
0.0132mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|